For research use only. Not for therapeutic Use.
Misetionamide（Cat No.:I043404）is a synthetic antineoplastic agent investigated for its potential in cancer therapy. Structurally related to sulfonamide compounds, Misetionamide exhibits cytotoxic activity by interfering with tumor cell metabolism and DNA synthesis. It has been explored for its ability to inhibit the growth of various cancer cell lines, particularly in solid tumors. While its precise mechanism of action is not fully defined, it is believed to involve disruption of cellular replication processes. Misetionamide represents a candidate for further development in oncology, especially in combination with other chemotherapeutic agents to enhance anticancer efficacy.
| CAS Number | 856785-75-6 |
| Synonyms | 1,4,3-oxathiazinane 4,4-dioxide |
| Molecular Formula | C3H7NO3S |
| Purity | ≥95% |
| IUPAC Name | 1,4,3-oxathiazinane 4,4-dioxide |
| InChI | InChI=1S/C3H7NO3S/c5-8(6)2-1-7-3-4-8/h4H,1-3H2 |
| InChIKey | GHDARLKSYBCZRE-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)NCO1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
