For research use only. Not for therapeutic Use.
Mitapivat (Cat No.: I001039) is a small molecule allosteric activator of the pyruvate kinase-R (PKR) enzyme, which plays a key role in glycolysis. By activating PKR, mitapivat promotes the conversion of phosphoenolpyruvate (PEP) to pyruvate, leading to increased ATP production. This mechanism of action makes mitapivat a potential therapeutic agent for inherited red blood cells disorders, such as pyruvate kinase deficiency (PKD) and sickle cell disease (SCD). In clinical trials, mitapivat has shown promising results in improving red blood cell parameters, reducing hemolysis, and increasing hemoglobin levels in patients with PKD and SCD. It represents a novel approach to the treatment of these hematological disorders.
| Catalog Number | I001039 |
| CAS Number | 1260075-17-9 |
| Synonyms | Mitapivat; PKR-IN-1; UNII-2WTV10SIKH; 2WTV10SIKH; 1260075-17-9; |
| Molecular Formula | C24H26N4O3S |
| Purity | 98% |
| Target | Pyruvate Kinase |
| Target Protein | |
| Solubility | 10 mM in DMSO |
| Appearance | Solid |
| Storage | Dry, dark and at 2 - 8 °C for six months or -20°C for two years. |
| IUPAC Name | N-[4-[4-(cyclopropylmethyl)piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
| InChI | InChI=1S/C24H26N4O3S/c29-24(28-15-13-27(14-16-28)17-18-6-7-18)20-8-10-21(11-9-20)26-32(30,31)22-5-1-3-19-4-2-12-25-23(19)22/h1-5,8-12,18,26H,6-7,13-17H2 |
| InChIKey | XAYGBKHKBBXDAK-UHFFFAOYSA-N |
| SMILES | C1CC1CN2CCN(CC2)C(=O)C3=CC=C(C=C3)NS(=O)(=O)C4=CC=CC5=C4N=CC=C5 |
| Reference | <p style=”/line-height:25px/”> |
