For research use only. Not for therapeutic Use.
Mitochonic Acid 5（Cat No.:H000072） is a novel compound that enhances mitochondrial function and promotes cellular energy production. It plays a crucial role in protecting cells from oxidative stress and apoptosis by stabilizing mitochondrial membranes. This compound is significant in the study of neurodegenerative diseases, metabolic disorders, and age-related conditions, offering potential therapeutic benefits. By improving mitochondrial health, Mitochonic Acid 5 supports overall cellular vitality and resilience, making it a valuable tool in advanced biochemical research and the development of treatments targeting mitochondrial dysfunction.
| Catalog Number | H000072 |
| CAS Number | 1354707-41-7 |
| Synonyms | 4-(2,4-difluorophenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid |
| Molecular Formula | C18 H13 F2 N O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-(2,4-difluorophenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid |
| InChI | InChI=1S/C18H13F2NO3/c19-10-5-6-12(15(20)7-10)17(22)8-13(18(23)24)14-9-21-16-4-2-1-3-11(14)16/h1-7,9,13,21H,8H2,(H,23,24) |
| InChIKey | BOKQALWNGNLTOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(CC(=O)C3=C(C=C(C=C3)F)F)C(=O)O |
