For research use only. Not for therapeutic Use.
Mitonafide(Cat No.:R051029)is an investigational compound with potential anti-cancer properties. It is a derivative of the naturally occurring nucleoside, designed to target and inhibit mitochondrial function in cancer cells. By disrupting mitochondrial DNA replication and respiration, mitonafide induces apoptosis and impairs the survival of rapidly proliferating tumor cells. This action makes it a promising candidate for various cancer treatments. Its selective mechanism of action and ability to target the mitochondria in cancer cells may provide an effective strategy for overcoming tumor resistance and improving treatment outcomes in oncology.
CAS Number | 54824-17-8 |
Synonyms | 2-[2-(dimethylamino)ethyl]-5-nitrobenzo[de]isoquinoline-1,3-dione |
Molecular Formula | C16H15N3O4 |
Purity | ≥95% |
IUPAC Name | 2-[2-(dimethylamino)ethyl]-5-nitrobenzo[de]isoquinoline-1,3-dione |
InChI | InChI=1S/C16H15N3O4/c1-17(2)6-7-18-15(20)12-5-3-4-10-8-11(19(22)23)9-13(14(10)12)16(18)21/h3-5,8-9H,6-7H2,1-2H3 |
InChIKey | XXVLKDRPHSFIIB-UHFFFAOYSA-N |
SMILES | CN(C)CCN1C(=O)C2=CC=CC3=CC(=CC(=C32)C1=O)[N+](=O)[O-] |
Reference |
|