For research use only. Not for therapeutic Use.
Mitoxantrone（Cat No.:A000298）is a synthetic antineoplastic agent used primarily in the treatment of certain cancers, such as metastatic breast cancer and acute myeloid leukemia, as well as in multiple sclerosis. It works by inhibiting DNA replication and RNA synthesis, leading to cell death in rapidly dividing cancer cells. Mitoxantrone also acts as an immune system modulator, making it effective in managing autoimmune diseases. Due to its potent effects, it is used under strict medical supervision, as it can cause serious side effects, including cardiotoxicity and bone marrow suppression.
| Catalog Number | A000298 |
| CAS Number | 65271-80-9 |
| Synonyms | NA |
| Molecular Formula | C₂₂H₂₈N₄O₆ |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | 1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
| InChI | InChI=1S/C22H28N4O6/c27-11-9-23-5-7-25-13-1-2-14(26-8-6-24-10-12-28)18-17(13)21(31)19-15(29)3-4-16(30)20(19)22(18)32/h1-4,23-30H,5-12H2 |
| InChIKey | KKZJGLLVHKMTCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1NCCNCCO)C(=O)C3=C(C=CC(=C3C2=O)O)O)NCCNCCO |
