For research use only. Not for therapeutic Use.
Mitoxantrone hydrochloride（Cat No.:A000577）is an anthracenedione chemotherapeutic agent used primarily in the treatment of certain cancers, including metastatic prostate cancer, acute myeloid leukemia, and multiple sclerosis. It functions by intercalating into DNA and inhibiting topoisomerase II, leading to DNA strand breaks and apoptosis in rapidly dividing cancer cells. Mitoxantrone is known for its efficacy but may cause side effects such as myelosuppression, cardiotoxicity, and gastrointestinal disturbances. Its use in multiple sclerosis is aimed at reducing relapse rates and disease progression, highlighting its versatility as a therapeutic agent in oncology and neurology.
| Catalog Number | A000577 |
| CAS Number | 70476-82-3 |
| Synonyms | NSC-301739 |
| Molecular Formula | C22H28N4O6 • 2HCl |
| Purity | ≥95% |
| Target | Topoisomerase II |
| Storage | 3 years -20C powder |
| IUPAC Name | 1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione;dihydrochloride |
| InChI | InChI=1S/C22H28N4O6.2ClH/c27-11-9-23-5-7-25-13-1-2-14(26-8-6-24-10-12-28)18-17(13)21(31)19-15(29)3-4-16(30)20(19)22(18)32;;/h1-4,23-30H,5-12H2;2*1H |
| InChIKey | ZAHQPTJLOCWVPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1NCCNCCO)C(=O)C3=C(C=CC(=C3C2=O)O)O)NCCNCCO.Cl.Cl |
| Reference | <p> |
