For research use only. Not for therapeutic Use.
Mizagliflozin is a potent and selective sodium-glucose cotransporter 1 (SGLT1) inhibitor, primarily used in diabetes and metabolic disorder research. By inhibiting SGLT1, mizagliflozin reduces glucose absorption in the intestines, lowering postprandial blood glucose levels. This unique mechanism makes it particularly effective in managing type 2 diabetes by targeting glucose control independently of insulin pathways. Mizagliflozin’s role in improving glycemic control, along with its potential benefits for weight management and cardiovascular health, positions it as a promising candidate for the development of novel antidiabetic therapies.
| Catalog Number | I008003 |
| CAS Number | 666843-10-3 |
| Synonyms | 2,2-dimethyl-3-[3-[3-methyl-4-[[5-propan-2-yl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenoxy]propylamino]propanamide |
| Molecular Formula | C28H44N4O8 |
| Purity | ≥95% |
| InChI | InChI=1S/C28H44N4O8/c1-15(2)21-19(25(32-31-21)40-26-24(36)23(35)22(34)20(13-33)39-26)12-17-7-8-18(11-16(17)3)38-10-6-9-30-14-28(4,5)27(29)37/h7-8,11,15,20,22-24,26,30,33-36H,6,9-10,12-14H2,1-5H3,(H2,29,37)(H,31,32)/t20-,22-,23+,24-,26+/m1/s1 |
| InChIKey | LREHMKLEOJAVMQ-TXKDOCKMSA-N |
| SMILES | CC1=C(C=CC(=C1)OCCCNCC(C)(C)C(=O)N)CC2=C(NN=C2OC3C(C(C(C(O3)CO)O)O)O)C(C)C |
