For research use only. Not for therapeutic Use.
MJN228（Cat No.:R034322）is a small-molecule inhibitor of the bromodomain and extra-terminal (BET) family of proteins, which are key regulators of gene expression through their interaction with acetylated lysine residues on histones. By inhibiting BET proteins, MJN228 disrupts the transcription of genes involved in cell proliferation, survival, and inflammation, particularly in cancer cells. Its selective inhibition of BET proteins makes it a promising candidate for cancer therapy, as it can target oncogenes such as MYC. MJN228 is also being explored for its potential to treat inflammatory diseases and other disorders driven by aberrant gene expression.
| CAS Number | 459168-97-9 |
| Synonyms | (4-methylpiperazin-1-yl)-(5-nitro-3-phenyl-1H-indol-2-yl)methanone |
| Molecular Formula | C20H20N4O3 |
| Purity | ≥95% |
| IUPAC Name | (4-methylpiperazin-1-yl)-(5-nitro-3-phenyl-1H-indol-2-yl)methanone |
| InChI | InChI=1S/C20H20N4O3/c1-22-9-11-23(12-10-22)20(25)19-18(14-5-3-2-4-6-14)16-13-15(24(26)27)7-8-17(16)21-19/h2-8,13,21H,9-12H2,1H3 |
| InChIKey | BLSWPPPBUQFKHH-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=C(C3=C(N2)C=CC(=C3)[N+](=O)[O-])C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
