For research use only. Not for therapeutic Use.
MK-3402（Cat No.:I042311）is a small molecule compound developed by Merck, primarily being investigated for its potential in cancer treatment. It functions by targeting specific signaling pathways involved in cancer cell growth and survival. MK-3402 has shown promise in preclinical studies for inhibiting tumor proliferation, particularly in cancers that rely on certain molecular pathways for growth. It is being researched for its ability to work in combination with other therapies to enhance overall treatment efficacy. Ongoing clinical trials aim to assess its safety, pharmacokinetics, and effectiveness in treating various cancers.
| Catalog Number | I042311 |
| CAS Number | 2058151-78-1 |
| Synonyms | 1-N-[(2R)-3-amino-2-hydroxypropyl]-4-(6-aminopyridin-3-yl)-3-(2H-tetrazol-5-yl)benzene-1,2-disulfonamide |
| Molecular Formula | C15H19N9O5S2 |
| Purity | ≥95% |
| IUPAC Name | 1-N-[(2R)-3-amino-2-hydroxypropyl]-4-(6-aminopyridin-3-yl)-3-(2H-tetrazol-5-yl)benzene-1,2-disulfonamide |
| InChI | InChI=1S/C15H19N9O5S2/c16-5-9(25)7-20-31(28,29)11-3-2-10(8-1-4-12(17)19-6-8)13(14(11)30(18,26)27)15-21-23-24-22-15/h1-4,6,9,20,25H,5,7,16H2,(H2,17,19)(H2,18,26,27)(H,21,22,23,24)/t9-/m1/s1 |
| InChIKey | FPDSKARHYNDHLY-SECBINFHSA-N |
| SMILES | C1=CC(=NC=C1C2=C(C(=C(C=C2)S(=O)(=O)NC[C@@H](CN)O)S(=O)(=O)N)C3=NNN=N3)N |
