For research use only. Not for therapeutic Use.
MK-3903 (Cat No.:I012945) is a potent and selective activator of AMP-activated protein kinase (AMPK). AMPK is an enzyme that plays a crucial role in cellular energy homeostasis by regulating various metabolic pathways. By activating AMPK, MK-3903 enhances cellular energy production, such as glucose uptake and fatty acid oxidation, while suppressing energy-consuming processes. This activation of AMPK can have broad pharmacologic effects, including improved glucose regulation, enhanced insulin sensitivity, and potential benefits for metabolic disorders such as type 2 diabetes and obesity.
| Catalog Number | I012945 |
| CAS Number | 1219737-12-8 |
| Molecular Formula | C₂₇H₁₉ClN₂O₃ |
| Purity | ≥95% |
| Target | AMPK |
| Solubility | DMSO: 75 mg/mL |
| IUPAC Name | 5-[[6-chloro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid |
| InChI | InChI=1S/C27H19ClN2O3/c1-16-7-12-20(13-21(16)26(31)32)33-27-29-24-14-22(23(28)15-25(24)30-27)19-10-8-18(9-11-19)17-5-3-2-4-6-17/h2-15H,1H3,(H,29,30)(H,31,32) |
| InChIKey | FIKQZQDYGXAUHC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=NC3=C(N2)C=C(C(=C3)C4=CC=C(C=C4)C5=CC=CC=C5)Cl)C(=O)O |
| Reference | [1]. Lan P, Romero FA, et al. Hit-to-Lead Optimization and Discovery of 5-((5-([1,1//’-Biphenyl]-4-yl)-6-chloro-1H-benzo[d]imidazol-2-yl)oxy)-2-methylbenzoic Acid (MK-3903): A Novel Class of Benzimidazole-Based Activators of AMP-Activated Protein Kinase. J Med Chem. 2017 Nov 9;60(21):9040-9052. |
