For research use only. Not for therapeutic Use.
MK-3984(CAT: I008063) is a selective androgen receptor modulator (SARM) designed to prevent and treat muscle wasting associated with cancer (cachexia). By selectively activating androgen receptors in muscle tissue, it promotes anabolic activity while minimizing androgenic effects on other tissues. This targeted mechanism makes it a valuable tool in oncology research, particularly in understanding and addressing cancer-related muscle atrophy. MK-3984 is instrumental in exploring therapeutic strategies for improving muscle mass and function, offering potential benefits for enhancing the quality of life in cancer patients. Its high specificity and efficacy position it as a cornerstone in cachexia research and drug development.
CAS Number | 871325-55-2 |
Synonyms | MK3984; MK 3984; MK-3984;(R)-3,3,3-trifluoro-N-(2-fluoro-5-(trifluoromethyl)benzyl)-2-hydroxy-2-phenylpropanamide |
Molecular Formula | C17H12F7NO2 |
Purity | ≥95% |
Target | Androgen Receptor |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | (2R)-3,3,3-trifluoro-N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-hydroxy-2-phenylpropanamide |
InChI | InChI=1S/C17H12F7NO2/c18-13-7-6-12(16(19,20)21)8-10(13)9-25-14(26)15(27,17(22,23)24)11-4-2-1-3-5-11/h1-8,27H,9H2,(H,25,26)/t15-/m1/s1 |
InChIKey | YSMGNNKNGUPHCD-OAHLLOKOSA-N |
SMILES | O=C(NCC1=CC(C(F)(F)F)=CC=C1F)[C@@](C2=CC=CC=C2)(O)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |