For research use only. Not for therapeutic Use.
MK-4101(Cat No.:I005555)is a selective small molecule inhibitor of the enzyme phosphodiesterase 4 (PDE4), which plays a key role in regulating cyclic AMP (cAMP) levels within cells. By inhibiting PDE4, MK-4101 increases cAMP levels, leading to anti-inflammatory effects. This makes it a promising candidate for treating conditions associated with inflammation, such as chronic obstructive pulmonary disease (COPD), asthma, and psoriasis. Additionally, MK-4101 may have applications in neurological disorders, where PDE4 inhibition has been linked to potential cognitive and mood-enhancing effects. Further clinical studies are needed to evaluate its safety and efficacy.
CAS Number | 935273-79-3 |
Synonyms | MK4101;MK 4101 |
Molecular Formula | C₂₄H₂₄F₅N₅O |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: 10 mM |
Storage | Store at -20°C |
IUPAC Name | 5-(3,3-difluorocyclobutyl)-3-[4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-1-bicyclo[2.2.2]octanyl]-1,2,4-oxadiazole |
InChI | InChI=1S/C24H24F5N5O/c1-34-17(15-4-2-3-5-16(15)24(27,28)29)31-32-20(34)22-9-6-21(7-10-22,8-11-22)19-30-18(35-33-19)14-12-23(25,26)13-14/h2-5,14H,6-13H2,1H3 |
InChIKey | HKJOIWLYDJCTQR-UHFFFAOYSA-N |
SMILES | CN1C(=NN=C1C23CCC(CC2)(CC3)C4=NOC(=N4)C5CC(C5)(F)F)C6=CC=CC=C6C(F)(F)F |