For research use only, not for therapeutic use.
MK-4827 (also known as Niraparib)(Cat No.:I000230)is a potent, selective inhibitor of poly(ADP-ribose) polymerase (PARP), an enzyme involved in DNA repair. By inhibiting PARP, MK-4827 induces synthetic lethality in cancer cells with deficiencies in homologous recombination repair mechanisms, such as those with BRCA1/2 mutations. This makes it particularly effective in treating ovarian, breast, and other cancers with such genetic vulnerabilities. MK-4827 has shown promise in both preclinical and clinical studies, making it a valuable tool in oncology research and a potential therapeutic option for targeted cancer treatment.
Catalog Number | I000230 |
CAS Number | 1038915-60-4 |
Synonyms | 2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide |
Molecular Formula | C₁₉H₂₀N₄O |
Purity | ≥95% |
Target | PARP |
Solubility | DMSO: ≥ 34 mg/mL |
Storage | 3 years -20℃ powder |
IC50 | 3.8 nM/2.1 nM( PARP1/2) [1] |
IUPAC Name | 2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide |
InChI | InChI=1S/C19H20N4O/c20-19(24)17-5-1-3-15-12-23(22-18(15)17)16-8-6-13(7-9-16)14-4-2-10-21-11-14/h1,3,5-9,12,14,21H,2,4,10-11H2,(H2,20,24)/t14-/m1/s1 |
InChIKey | PCHKPVIQAHNQLW-CQSZACIVSA-N |
SMILES | C1CC(CNC1)C2=CC=C(C=C2)N3C=C4C=CC=C(C4=N3)C(=O)N |
Reference | <p style=/line-height:25px/> |