For research use only. Not for therapeutic Use.
MK571 sodium salt is a specific CysLT1 (cysteinyl-leukotriene receptor type 1) antagonist. MK571 is a multidrug resistance protein 2 (ABCC2, Mrp2) inhibitor that has been widely used to demonstrate the role of Mrp2 in the efflux of drugs, xenobiotics and their conjugates. MK571 inhibits K-4′-O-GlcA synthesis with an estimated Ki of 19.7 μM.
| Catalog Number | I000560 |
| CAS Number | 115103-85-0 |
| Synonyms | 5-(3-(2-(7-Chloroquinolin-2-yl)ethenyl)phenyl)-8-dimethylcarbamyl-4,6-dithiaoctanoic acid sodium salt hydrate |
| Molecular Formula | C₂₆H₂₆ClN₂O₃S₂.Na |
| Purity | ≥95% |
| Target | Leukotriene Receptor |
| Solubility | DMSO: ≥ 33 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | sodium;3-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-[3-(dimethylamino)-3-oxopropyl]sulfanylmethyl]sulfanylpropanoate |
| InChI | InChI=1S/C26H27ClN2O3S2.Na/c1-29(2)24(30)12-14-33-26(34-15-13-25(31)32)20-5-3-4-18(16-20)6-10-22-11-8-19-7-9-21(27)17-23(19)28-22;/h3-11,16-17,26H,12-15H2,1-2H3,(H,31,32);/q;+1/p-1/b10-6+; |
| InChIKey | XNAYQOBPAXEYLI-AAGWESIMSA-M |
| SMILES | CN(C)C(=O)CCSC(C1=CC=CC(=C1)C=CC2=NC3=C(C=CC(=C3)Cl)C=C2)SCCC(=O)[O-].[Na+] |
