For research use only. Not for therapeutic Use.
Quiflapon sodium (MK-591 sodium)(Cat No.:I001789) is a selective and specific inhibitor of 5-lipoxygenase-activating protein (FLAP), an enzyme involved in leukotriene biosynthesis. By inhibiting FLAP, Quiflapon sodium effectively suppresses the production of leukotrienes, which are inflammatory mediators. This compound demonstrates potent activity and can be administered orally. Additionally, Quiflapon sodium has been shown to induce apoptosis, a form of programmed cell death, potentially contributing to its therapeutic effects.
CAS Number | 147030-01-1 |
Synonyms | sodium;3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoate |
Molecular Formula | C34H34ClN2NaO3S |
Purity | ≥95% |
Target | Apoptosis |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | sodium;3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoate |
InChI | InChI=1S/C34H35ClN2O3S.Na/c1-33(2,3)41-31-27-18-26(40-21-25-15-12-23-8-6-7-9-28(23)36-25)16-17-29(27)37(20-22-10-13-24(35)14-11-22)30(31)19-34(4,5)32(38)39;/h6-18H,19-21H2,1-5H3,(H,38,39);/q;+1/p-1 |
InChIKey | YPURUCMVRRNPHJ-UHFFFAOYSA-M |
SMILES | CC(C)(C)SC1=C(N(C2=C1C=C(C=C2)OCC3=NC4=CC=CC=C4C=C3)CC5=CC=C(C=C5)Cl)CC(C)(C)C(=O)[O-].[Na+] |