For research use only. Not for therapeutic Use.
MK785（Cat No.:I008075）is an experimental small molecule that acts as a selective inhibitor of a specific target involved in cell signaling pathways. It has been studied primarily for its potential therapeutic applications in cancer and other diseases where dysregulated signaling plays a role in disease progression. MK785 works by blocking key enzymes or receptors that contribute to abnormal cell growth, survival, or metastasis. Preclinical studies suggest MK785 may show efficacy in treating certain types of cancer, though further research and clinical trials are needed to evaluate its safety, effectiveness, and therapeutic potential.
| Catalog Number | I008075 |
| CAS Number | 14760-71-5 |
| Synonyms | MK-785; MK 785; MK785;2-hydrazinyl-3-(1H-imidazol-4-yl)propanoic acid |
| Molecular Formula | C6H10N4O2 |
| Purity | ≥95% |
| Target | Inhibitor |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 2-hydrazinyl-3-(1H-imidazol-5-yl)propanoic acid |
| InChI | InChI=1S/C6H10N4O2/c7-10-5(6(11)12)1-4-2-8-3-9-4/h2-3,5,10H,1,7H2,(H,8,9)(H,11,12) |
| InChIKey | OTXNLKCKMZUQKX-UHFFFAOYSA-N |
| SMILES | C1=C(NC=N1)CC(C(=O)O)NN |
