For research use only. Not for therapeutic Use.
MK785 is part of the relationship between inhibition of aortic histamine formation, aortic albumin permeability and atherosclerosis. Aortic histamine synthesis is inhibited by partial inhibition of aortic histidine decarboxylase (HD) through administration of MK785.
| Catalog Number | I008075 |
| CAS Number | 14760-71-5 |
| Synonyms | MK-785; MK 785; MK785;2-hydrazinyl-3-(1H-imidazol-4-yl)propanoic acid |
| Molecular Formula | C6H10N4O2 |
| Purity | ≥95% |
| Target | Inhibitor |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 2-hydrazinyl-3-(1H-imidazol-5-yl)propanoic acid |
| InChI | InChI=1S/C6H10N4O2/c7-10-5(6(11)12)1-4-2-8-3-9-4/h2-3,5,10H,1,7H2,(H,8,9)(H,11,12) |
| InChIKey | OTXNLKCKMZUQKX-UHFFFAOYSA-N |
| SMILES | C1=C(NC=N1)CC(C(=O)O)NN |
| Reference | </br>1: Owens GK, Hollis TM. Relationship between inhibition of aortic histamine formation, aortic albumin permeability and atherosclerosis. Atherosclerosis. 1979 Dec;34(4):365-73. PubMed PMID: 518743. |
