For research use only. Not for therapeutic Use.
MKC-1(Cat No.:M134416)is an orally bioavailable small molecule inhibitor with antitumor activity. It targets multiple pathways, including inhibition of tubulin polymerization, leading to disruption of microtubule dynamics, and also modulates Akt signaling, thereby affecting cell cycle progression and promoting apoptosis. MKC-1 has demonstrated efficacy against various cancer cell lines, particularly in breast, lung, and ovarian cancers. Its unique mechanism of action makes it effective in overcoming resistance to conventional chemotherapeutics. MKC-1 is valuable for cancer research, providing insights into multi-pathway inhibition for enhanced anticancer effects.
CAS Number | 125313-92-0 |
Molecular Formula | C22H16N4O4 |
Purity | ≥95% |
Target | Cytoskeleton |
Storage | -20°C |
IUPAC Name | 3-(1-methylindol-3-yl)-4-(1-methyl-6-nitroindol-3-yl)pyrrole-2,5-dione |
InChI | InChI=1S/C22H16N4O4/c1-24-10-15(13-5-3-4-6-17(13)24)19-20(22(28)23-21(19)27)16-11-25(2)18-9-12(26(29)30)7-8-14(16)18/h3-11H,1-2H3,(H,23,27,28) |
InChIKey | OVSKGTONMLKNPZ-UHFFFAOYSA-N |
SMILES | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=CN(C5=C4C=CC(=C5)[N+](=O)[O-])C |