For research use only. Not for therapeutic Use.
ML 18(Cat No.:I011250)is a potent and selective inhibitor of the cannabinoid receptor type 2 (CB2), which is primarily involved in modulating immune responses and inflammation. By specifically targeting CB2 receptors, ML 18 plays a crucial role in research related to immune regulation, inflammation, and neuroprotection, without affecting CB1 receptors associated with psychoactive effects. This makes it a valuable tool in exploring therapeutic avenues for conditions such as autoimmune disorders, chronic pain, and neurodegenerative diseases, offering insights into CB2’s therapeutic potential without central nervous system side effects.
CAS Number | 1422269-30-4 |
Synonyms | (αS)-N-[[1-(4-Methoxyphenyl)cyclohexyl]methyl-α-[[[(4-nitrophenyl)amino]carbonyl]amino]-1H-indole-3-propanamide |
Molecular Formula | C32H35N5O5 |
Purity | ≥95% |
Target | Bombesin Receptor |
Solubility | Soluble to 100 mM in DMSO |
Storage | 2-8°C |
IUPAC Name | (2S)-3-(1H-indol-3-yl)-N-[[1-(4-methoxyphenyl)cyclohexyl]methyl]-2-[(4-nitrophenyl)carbamoylamino]propanamide |
InChI | InChI=1S/C32H35N5O5/c1-42-26-15-9-23(10-16-26)32(17-5-2-6-18-32)21-34-30(38)29(19-22-20-33-28-8-4-3-7-27(22)28)36-31(39)35-24-11-13-25(14-12-24)37(40)41/h3-4,7-16,20,29,33H,2,5-6,17-19,21H2,1H3,(H,34,38)(H2,35,36,39)/t29-/m0/s1 |
InChIKey | JOKVJNCYOSFDGC-LJAQVGFWSA-N |
SMILES | COC1=CC=C(C=C1)C2(CCCCC2)CNC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)NC5=CC=C(C=C5)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |