ML 18（Cat No.:I011250）is a potent and selective inhibitor of the cannabinoid receptor type 2 (CB2), which is primarily involved in modulating immune responses and inflammation. By specifically targeting CB2 receptors, ML 18 plays a crucial role in research related to immune regulation, inflammation, and neuroprotection, without affecting CB1 receptors associated with psychoactive effects. This makes it a valuable tool in exploring therapeutic avenues for conditions such as autoimmune disorders, chronic pain, and neurodegenerative diseases, offering insights into CB2’s therapeutic potential without central nervous system side effects.
| Catalog Number | I011250 |
| CAS Number | 1422269-30-4 |
| Synonyms | (αS)-N-[[1-(4-Methoxyphenyl)cyclohexyl]methyl-α-[[[(4-nitrophenyl)amino]carbonyl]amino]-1H-indole-3-propanamide |
| Molecular Formula | C32H35N5O5 |
| Purity | ≥95% |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | 2-8°C |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-N-[[1-(4-methoxyphenyl)cyclohexyl]methyl]-2-[(4-nitrophenyl)carbamoylamino]propanamide |
| InChI | InChI=1S/C32H35N5O5/c1-42-26-15-9-23(10-16-26)32(17-5-2-6-18-32)21-34-30(38)29(19-22-20-33-28-8-4-3-7-27(22)28)36-31(39)35-24-11-13-25(14-12-24)37(40)41/h3-4,7-16,20,29,33H,2,5-6,17-19,21H2,1H3,(H,34,38)(H2,35,36,39)/t29-/m0/s1 |
| InChIKey | JOKVJNCYOSFDGC-LJAQVGFWSA-N |
| SMILES | COC1=CC=C(C=C1)C2(CCCCC2)CNC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)NC5=CC=C(C=C5)[N+](=O)[O-] |
