For research use only, not for therapeutic use.
ML-324（Cat No.:I000852）is a selective inhibitor of the histone methyltransferase G9a, which plays a critical role in regulating gene expression through the methylation of histone H3 at lysine 9 (H3K9me1/2). By inhibiting G9a, ML-324 can reactivate silenced tumor suppressor genes and disrupt oncogenic signaling pathways. This compound has shown promising anti-cancer effects in preclinical studies, particularly in various solid tumors and hematological malignancies where G9a is overexpressed. ML-324’s ability to modulate epigenetic regulation positions it as a significant candidate for developing targeted therapies in cancer treatment.
| Catalog Number | I000852 |
| CAS Number | 1222800-79-4 |
| Synonyms | N-(3-(dimethylamino)propyl)-4-(8-hydroxyquinolin-6-yl)benzamide |
| Molecular Formula | C₂₁H₂₃N₃O₂ |
| Purity | ≥95% |
| Target | Histone Demethylases |
| Solubility | DMSO: ≥ 33 mg/mL |
| Storage | Store at -20°C |
| IC50 | 920 nM(JMJD2E) [1] |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-(8-hydroxyquinolin-6-yl)benzamide |
| InChI | InChI=1S/C21H23N3O2/c1-24(2)12-4-11-23-21(26)16-8-6-15(7-9-16)18-13-17-5-3-10-22-20(17)19(25)14-18/h3,5-10,13-14,25H,4,11-12H2,1-2H3,(H,23,26) |
| InChIKey | QDBVSOZTVKXUES-UHFFFAOYSA-N |
| SMILES | CN(C)CCCNC(=O)C1=CC=C(C=C1)C2=CC(=C3C(=C2)C=CC=N3)O |
| Reference | <p style=/line-height:25px/> |
