For research use only. Not for therapeutic Use.
ML095（Cat No.:R060692）is a small molecule inhibitor that targets and blocks the activity of the protein methyltransferase Set7/9, an enzyme involved in regulating gene expression through histone modifications. By inhibiting Set7/9, ML095 affects the methylation of histone H3, thereby influencing transcriptional regulation. It has shown potential in preclinical studies for modulating inflammatory responses and immune system regulation. ML095 is being investigated for its therapeutic potential in treating diseases related to abnormal gene expression, such as cancer, autoimmune disorders, and other conditions involving dysregulated epigenetic mechanisms.
| CAS Number | 1135318-57-8 |
| Synonyms | 1-(3,4-dihydroxyphenyl)-2-(2-ethylimidazol-1-yl)ethanone;hydrochloride |
| Molecular Formula | C13H15ClN2O3 |
| Purity | ≥95% |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-(2-ethylimidazol-1-yl)ethanone;hydrochloride |
| InChI | InChI=1S/C13H14N2O3.ClH/c1-2-13-14-5-6-15(13)8-12(18)9-3-4-10(16)11(17)7-9;/h3-7,16-17H,2,8H2,1H3;1H |
| InChIKey | VTSPJLHFXSMCCC-UHFFFAOYSA-N |
| SMILES | CCC1=NC=CN1CC(=O)C2=CC(=C(C=C2)O)O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
