For research use only. Not for therapeutic Use.
ML115(CAT: R065003) is a selective molecular probe that functions as an agonist of the signal transducer and activator of transcription 3 (STAT3). As a STAT3 agonist, ML115 promotes the activation of STAT3 signaling pathways, which are critical for regulating cell growth, survival, differentiation, and immune responses. This compound is particularly useful in probing the physiological and pathological roles of STAT3, including its involvement in tissue regeneration, immune modulation, and cancer biology. ML115 serves as a valuable research tool for studying STAT3-mediated transcriptional activity and exploring therapeutic strategies targeting STAT3 in diseases such as cancer, inflammation, and autoimmune disorders.
| CAS Number | 912798-42-6 |
| Synonyms | N-(4-chloro-2,5-dimethoxyphenyl)-5-cyclopropyl-1,2-oxazole-3-carboxamide |
| Molecular Formula | C15H15ClN2O4 |
| Purity | ≥95% |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-5-cyclopropyl-1,2-oxazole-3-carboxamide |
| InChI | InChI=1S/C15H15ClN2O4/c1-20-13-6-10(14(21-2)5-9(13)16)17-15(19)11-7-12(22-18-11)8-3-4-8/h5-8H,3-4H2,1-2H3,(H,17,19) |
| InChIKey | FMWABCRYNLCXOJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1NC(=O)C2=NOC(=C2)C3CC3)OC)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
