For research use only. Not for therapeutic Use.
ML115 is a molecular probe of the signal transducer and activator of transcription (STAT3). ML115 is a STAT3 agonist[1].
| Catalog Number | R065003 |
| CAS Number | 912798-42-6 |
| Synonyms | N-(4-chloro-2,5-dimethoxyphenyl)-5-cyclopropyl-1,2-oxazole-3-carboxamide |
| Molecular Formula | C15H15ClN2O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C15H15ClN2O4/c1-20-13-6-10(14(21-2)5-9(13)16)17-15(19)11-7-12(22-18-11)8-3-4-8/h5-8H,3-4H2,1-2H3,(H,17,19) |
| InChIKey | FMWABCRYNLCXOJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1NC(=O)C2=NOC(=C2)C3CC3)OC)Cl |
| Reference | [1]. Wu C, et al. Spectroscopic investigations and molecular docking analysis of ML115: A potential molecular probe of the signal transducer and activator of transcription. Journal of Molecular Structure, 2019, 1175: 638-647. |
