For research use only. Not for therapeutic Use.
ML126（Cat No.:I012437）is a small molecule compound that acts as a selective antagonist of the protein, the Transient Receptor Potential Vanilloid 4 (TRPV4). TRPV4 is a calcium-permeable ion channel involved in various physiological processes, including inflammation, pain sensation, and vascular function. ML126 has been studied for its potential therapeutic applications in conditions such as neuropathic pain, inflammation, and cardiovascular diseases. By inhibiting TRPV4, ML126 may reduce excessive calcium influx, which is implicated in pathological conditions. Preclinical studies suggest it could offer a novel approach in managing these conditions, though clinical trials are still required.
| Catalog Number | I012437 |
| CAS Number | 344874-84-6 |
| Synonyms | Carbazol-9-yl-(4-methylphenyl)methanone; ML-126 |
| Molecular Formula | C20H15NO |
| Purity | ≥95% |
| IUPAC Name | carbazol-9-yl-(4-methylphenyl)methanone |
| InChI | InChI=1S/C20H15NO/c1-14-10-12-15(13-11-14)20(22)21-18-8-4-2-6-16(18)17-7-3-5-9-19(17)21/h2-13H,1H3 |
| InChIKey | AWZNVFKAFFHLEY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)N2C3=CC=CC=C3C4=CC=CC=C42 |
