For research use only. Not for therapeutic Use.
ML148（Cat No.:R066782）is a small molecule inhibitor that selectively targets the protein histone deacetylase 6 (HDAC6), an enzyme involved in regulating cellular processes such as protein aggregation, microtubule dynamics, and stress response. By inhibiting HDAC6, ML148 has shown potential in enhancing protein degradation, promoting neuroprotection, and improving cell function. It has been explored for therapeutic applications in neurodegenerative diseases, such as Alzheimer’s and Parkinson’s, as well as in cancer therapy. ML148’s ability to modulate cellular pathways associated with neuroinflammation and protein misfolding makes it a promising candidate for further investigation in treating various diseases.
| CAS Number | 451496-96-1 |
| Synonyms | [1-(3-methylphenyl)benzimidazol-5-yl]-piperidin-1-ylmethanone |
| Molecular Formula | C20H21N3O |
| Purity | ≥95% |
| IUPAC Name | [1-(3-methylphenyl)benzimidazol-5-yl]-piperidin-1-ylmethanone |
| InChI | InChI=1S/C20H21N3O/c1-15-6-5-7-17(12-15)23-14-21-18-13-16(8-9-19(18)23)20(24)22-10-3-2-4-11-22/h5-9,12-14H,2-4,10-11H2,1H3 |
| InChIKey | YQNOQZALLOQMPY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C=NC3=C2C=CC(=C3)C(=O)N4CCCCC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
