For research use only. Not for therapeutic Use.
ML179（Cat No.:R065004）is a potent and selective small molecule inhibitor targeting the TCF7L2 (T-cell factor 7-like 2) protein, which plays a crucial role in Wnt signaling and is associated with various diseases, including cancer and metabolic disorders. ML179 specifically inhibits the interaction between TCF7L2 and beta-catenin, preventing Wnt signaling activation. This compound has shown promise in preclinical studies as a potential therapeutic agent for cancers, particularly colorectal cancer, and metabolic diseases like type 2 diabetes, by modulating the Wnt pathway and influencing insulin resistance and glucose metabolism.
| CAS Number | 1883548-87-5 |
| Synonyms | 3-cyclohexyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyrimidine-2,4-dione |
| Molecular Formula | C21H25F3N4O2 |
| Purity | ≥95% |
| IUPAC Name | 3-cyclohexyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C21H25F3N4O2/c22-21(23,24)15-5-4-8-17(13-15)26-9-11-27(12-10-26)18-14-19(29)28(20(30)25-18)16-6-2-1-3-7-16/h4-5,8,13-14,16H,1-3,6-7,9-12H2,(H,25,30) |
| InChIKey | MFABFKUNLDYKGH-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2C(=O)C=C(NC2=O)N3CCN(CC3)C4=CC=CC(=C4)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
