For research use only. Not for therapeutic Use.
ML216 (CAT: I001652) is a potent inhibitor of BLM helicase, an enzyme involved in DNA unwinding processes. It demonstrates strong inhibitory activity against both full-length BLM helicase and a truncated form known as BLM636–1298, with IC50 values of approximately 3.0 μM and 0.97 μM, respectively. By inhibiting BLM helicase activity, ML216 interferes with the unwinding of DNA helices and disrupts crucial DNA replication and repair processes. This inhibition has the potential to impair the growth and survival of cancer cells that rely on efficient DNA replication and repair mechanisms. Further research is warranted to explore the therapeutic applications of ML216 as an anticancer agent targeting BLM helicase.
| Catalog Number | I001652 |
| CAS Number | 1430213-30-1 |
| Synonyms | CID-49852229 |
| Molecular Formula | C15H9F4N5OS |
| Purity | ≥95% |
| Target | DNA/RNA Synthesis |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IC50 | 3.0/0.97 uM(Full length/636–1298 BLM) |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)urea |
| InChI | InChI=1S/C15H9F4N5OS/c16-11-2-1-9(7-10(11)15(17,18)19)21-13(25)22-14-24-23-12(26-14)8-3-5-20-6-4-8/h1-7H,(H2,21,22,24,25) |
| InChIKey | WMCOYUSJXXCHFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)NC2=NN=C(S2)C3=CC=NC=C3)C(F)(F)F)F |
| Reference | <span style=”color:#000000;”><span style=”font-size:12px;”><span style=”font-family:arial,helvetica,sans-serif;”>1.Nguyen, Giang Huong, et al. "A small molecule inhibitor of the BLM helicase modulates chromosome stability in human cells." <i style=”font-family: Arial, sans-serif; font-size: 13px;”>Chemistry & biology</i> 20.1 (2013): 55-62.</span></span></span> |
