For research use only. Not for therapeutic Use.
ML230(CAT: I012420) is a small-molecule inhibitor known for its role in drug discovery and biochemical research, particularly in the study of enzyme inhibition. This compound is often used in high-throughput screening assays to explore its potential as a therapeutic agent by targeting specific proteins or enzymes involved in various diseases. ML230 has garnered attention for its selectivity and potency, making it an essential tool in the identification and validation of new drug targets. Researchers focused on medicinal chemistry, pharmacology, and enzyme kinetics use ML230 to investigate novel therapeutic pathways and to develop more effective treatments for a range of conditions.
| Catalog Number | I012420 |
| CAS Number | 1776055-05-0 |
| Synonyms | Furan-3-yl-[4-[5-(furan-2-yl)-2-phenylpyrazolo[1,5-a]pyrimidin-7-yl]piperazin-1-yl]methanone |
| Molecular Formula | C25H21N5O3 |
| Purity | ≥95% |
| Target | BCRP |
| IUPAC Name | furan-3-yl-[4-[5-(furan-2-yl)-2-phenylpyrazolo[1,5-a]pyrimidin-7-yl]piperazin-1-yl]methanone |
| InChI | InChI=1S/C25H21N5O3/c31-25(19-8-14-32-17-19)29-11-9-28(10-12-29)24-16-21(22-7-4-13-33-22)26-23-15-20(27-30(23)24)18-5-2-1-3-6-18/h1-8,13-17H,9-12H2 |
| InChIKey | LRPGMVPQQLBMNE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC(=NC3=CC(=NN32)C4=CC=CC=C4)C5=CC=CO5)C(=O)C6=COC=C6 |
