For research use only. Not for therapeutic Use.
ML254（Cat No.:I012415）is a selective small molecule inhibitor of the enzyme bromodomain-containing protein 4 (BRD4), which plays a key role in regulating gene expression through its interaction with acetylated histones. By inhibiting BRD4, ML254 disrupts the transcriptional regulation of genes involved in cell cycle progression and survival, making it a potential therapeutic agent for cancer. ML254 has shown promise in preclinical studies for its ability to target and inhibit the growth of various cancer cells, particularly in hematologic cancers. Its specificity for BRD4 also suggests potential applications in other diseases involving aberrant gene regulation.
| CAS Number | 1428630-86-7 |
| Synonyms | 5-[2-(3-fluorophenyl)ethynyl]-N-(3-methyloxetan-3-yl)pyridine-2-carboxamide |
| Molecular Formula | C18H15FN2O2 |
| Purity | ≥95% |
| IUPAC Name | 5-[2-(3-fluorophenyl)ethynyl]-N-(3-methyloxetan-3-yl)pyridine-2-carboxamide |
| InChI | InChI=1S/C18H15FN2O2/c1-18(11-23-12-18)21-17(22)16-8-7-14(10-20-16)6-5-13-3-2-4-15(19)9-13/h2-4,7-10H,11-12H2,1H3,(H,21,22) |
| InChIKey | YMYCVXPMSMNWEP-UHFFFAOYSA-N |
| SMILES | CC1(COC1)NC(=O)C2=NC=C(C=C2)C#CC3=CC(=CC=C3)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
