For research use only. Not for therapeutic Use.
ML289 (VU0463597) is a potent, selective, and CNS-penetrant mGlu3 (IC50=0.66 μM) negative allosteric modulator. ML289 displays >15-fold selectivity over mGlu2 and is inactive against mGlu5[1]. ML289 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
ML289 (VU0463597) is a CNS-penetrant, metabotropic glutamate receptor 3 (mGlu3) negative allosteric modulator probe[1].
| Catalog Number | R032705 |
| CAS Number | 1382481-79-9 |
| Synonyms | [(3R)-3-(hydroxymethyl)piperidin-1-yl]-[4-[2-(4-methoxyphenyl)ethynyl]phenyl]methanone |
| Molecular Formula | C22H23NO3 |
| Purity | ≥95% |
| InChI | InChI=1S/C22H23NO3/c1-26-21-12-8-18(9-13-21)5-4-17-6-10-20(11-7-17)22(25)23-14-2-3-19(15-23)16-24/h6-13,19,24H,2-3,14-16H2,1H3/t19-/m1/s1 |
| InChIKey | VSLWUPHHCFQTDB-LJQANCHMSA-N |
| SMILES | COC1=CC=C(C=C1)C#CC2=CC=C(C=C2)C(=O)N3CCCC(C3)CO |
| Reference | [1]. Sheffler DJ, et al. Development of a novel, CNS-penetrant, metabotropic glutamate receptor 3 (mGlu3) NAM probe (ML289) derived from a closely related mGlu5 PAM. Bioorg Med Chem Lett. 2012;22(12):3921-3925. |
