For research use only. Not for therapeutic Use.
ML318 (Cat No.: I012409) is a chemical compound with emerging pharmacological potential. While detailed information is limited, preliminary research suggests it possesses promising activities in diverse scientific domains. However, the precise mechanism of action and specific therapeutic applications of ML318 are still under investigation. This compound’s properties make it an interesting candidate for further study, and researchers across various fields are actively exploring its potential for medical and scientific advancements.
| Catalog Number | I012409 |
| CAS Number | 1610516-67-0 |
| Synonyms | (4-Fluoro-phenyl)-(6-trifluoromethyl-pyridin-2-yl)-acetonitrile |
| Molecular Formula | C14H8F4N2 |
| Purity | ≥95% |
| IUPAC Name | 2-(4-fluorophenyl)-2-[6-(trifluoromethyl)pyridin-2-yl]acetonitrile |
| InChI | InChI=1S/C14H8F4N2/c15-10-6-4-9(5-7-10)11(8-19)12-2-1-3-13(20-12)14(16,17)18/h1-7,11H |
| InChIKey | DXQNDKQUHKVTTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(F)(F)F)C(C#N)C2=CC=C(C=C2)F |
