For research use only. Not for therapeutic Use.
ML318（Cat No.:I012409）is a potent and selective inhibitor of the mitochondrial enzyme human 2-oxoglutarate dehydrogenase (OGDH). By targeting this critical enzyme in the tricarboxylic acid (TCA) cycle, ML318 modulates cellular metabolism and has potential applications in studying metabolic reprogramming in cancer and neurological disorders. Its high specificity and favorable pharmacokinetic properties make it a valuable tool for probing mitochondrial function and bioenergetics. ML318’s ability to influence metabolic pathways offers promising opportunities for therapeutic exploration in diseases linked to mitochondrial dysfunction and altered cellular metabolism.
| Catalog Number | I012409 |
| CAS Number | 1610516-67-0 |
| Synonyms | (4-Fluoro-phenyl)-(6-trifluoromethyl-pyridin-2-yl)-acetonitrile |
| Molecular Formula | C14H8F4N2 |
| Purity | ≥95% |
| Target | Antibiotic |
| IUPAC Name | 2-(4-fluorophenyl)-2-[6-(trifluoromethyl)pyridin-2-yl]acetonitrile |
| InChI | InChI=1S/C14H8F4N2/c15-10-6-4-9(5-7-10)11(8-19)12-2-1-3-13(20-12)14(16,17)18/h1-7,11H |
| InChIKey | DXQNDKQUHKVTTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(F)(F)F)C(C#N)C2=CC=C(C=C2)F |
