For research use only. Not for therapeutic Use.
ML324（Cat No.:I013855）is a selective small-molecule inhibitor targeting the enzyme lysine-specific demethylase 1 (LSD1), which plays a crucial role in epigenetic regulation. By inhibiting LSD1, ML324 effectively modulates gene expression and alters chromatin dynamics, making it a valuable tool for studying epigenetic processes in cancer and other diseases. This compound has shown promise in preclinical models, particularly in enhancing the efficacy of certain cancer therapies by reversing epigenetic silencing of tumor suppressor genes. ML324’s specificity and potency make it a key candidate for further investigation in therapeutic development.
| Catalog Number | I013855 |
| CAS Number | 1222800-79-4 |
| Molecular Formula | C₂₁H₂₃N₃O₂ |
| Purity | ≥95% |
| Target | Histone Demethylase |
| Solubility | DMSO: ≥ 33 mg/mL |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-(8-hydroxyquinolin-6-yl)benzamide |
| InChI | InChI=1S/C21H23N3O2/c1-24(2)12-4-11-23-21(26)16-8-6-15(7-9-16)18-13-17-5-3-10-22-20(17)19(25)14-18/h3,5-10,13-14,25H,4,11-12H2,1-2H3,(H,23,26) |
| InChIKey | QDBVSOZTVKXUES-UHFFFAOYSA-N |
| SMILES | CN(C)CCCNC(=O)C1=CC=C(C=C1)C2=CC(=C3C(=C2)C=CC=N3)O |
| Reference | [1]. Rai G, et al. Discovery of ML324, a JMJD2 demethylase inhibitor with demonstrated antiviral activity. |
