For research use only. Not for therapeutic Use.
ML346 (CAT: I000100) is a novel activator of heat shock protein 70 (Hsp70). Hsp70 is a chaperone protein involved in cellular stress response and protein folding. ML346 has been shown to specifically induce the expression and activation of Hsp70, leading to enhanced cellular protection against various stressors, including oxidative stress and protein misfolding. This activation of Hsp70 can have potential therapeutic applications in diseases associated with protein misfolding, such as neurodegenerative disorders.
CAS Number | 100872-83-1 |
Molecular Formula | C14H12N2O4 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | DMSO:≥ 21 mg/mL |
Storage | 3 years -20C powder |
IC50 | 4600 nM (EC50) |
InChI | InChI=1S/C14H12N2O4/c1-20-10-7-5-9(6-8-10)3-2-4-11-12(17)15-14(19)16-13(11)18/h2-8H,1H3,(H2,15,16,17,18,19)/b3-2+ |
InChIKey | IXYLVJHFJKDHRM-NSCUHMNNSA-N |
SMILES | O=C(NC(NC/1=O)=O)C1=CC=CC2=CC=C(OC)C=C2 |
Reference | <p style=/line-height:25px/> |