For research use only. Not for therapeutic Use.
ML353（Cat No.:I041430）is a small-molecule inhibitor that targets the enzyme NAD+-dependent deacetylase sirtuin 2 (SIRT2), which plays a significant role in cellular processes like metabolism, aging, and neurodegenerative diseases. By inhibiting SIRT2, ML353 has shown potential in modulating neuroinflammation and improving motor function in models of Parkinson’s disease. Its ability to alter cellular pathways linked to neuroprotection and neurodegeneration makes it a promising candidate for the treatment of neurodegenerative disorders. Ongoing research is focused on evaluating its efficacy, safety, and potential therapeutic applications in both preclinical and clinical settings.
| CAS Number | 2990506-75-5 |
| Synonyms | 3-azabicyclo[3.1.0]hexan-3-yl-[5-[2-(3-fluorophenyl)ethynyl]pyridin-2-yl]methanone |
| Molecular Formula | C19H15FN2O |
| Purity | ≥95% |
| IUPAC Name | 3-azabicyclo[3.1.0]hexan-3-yl-[5-[2-(3-fluorophenyl)ethynyl]pyridin-2-yl]methanone |
| InChI | InChI=1S/C19H15FN2O/c20-17-3-1-2-13(8-17)4-5-14-6-7-18(21-10-14)19(23)22-11-15-9-16(15)12-22/h1-3,6-8,10,15-16H,9,11-12H2 |
| InChIKey | PEDQCOLPUZUUGO-UHFFFAOYSA-N |
| SMILES | C1C2C1CN(C2)C(=O)C3=NC=C(C=C3)C#CC4=CC(=CC=C4)F |
