For research use only. Not for therapeutic Use.
ML372 is a potent and selective inhibitor of the enzyme nicotinamide N-methyltransferase (NNMT), primarily used in metabolic and cancer research. NNMT plays a key role in the methylation of nicotinamide, influencing cellular energy metabolism and methylation balance. By inhibiting NNMT, ML372 has shown potential in modulating metabolic pathways, making it a valuable tool for studying disorders such as obesity, type 2 diabetes, and certain cancers. Its ability to alter cellular metabolism and reduce tumor growth in preclinical models highlights ML372’s therapeutic potential for developing treatments targeting metabolic diseases and cancer progression.
| Catalog Number | I008103 |
| CAS Number | 1331745-61-9 |
| Synonyms | 1-[5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1,3-thiazol-2-yl]piperidine-4-carboxylic acid |
| Molecular Formula | C18H20N2O4S |
| Purity | ≥95% |
| InChI | InChI=1S/C18H20N2O4S/c21-17(22)12-4-6-20(7-5-12)18-19-11-16(25-18)13-2-3-14-15(10-13)24-9-1-8-23-14/h2-3,10-12H,1,4-9H2,(H,21,22) |
| InChIKey | HAVNRFQWAXTDTI-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)C3=CN=C(S3)N4CCC(CC4)C(=O)O)OC1 |
