For research use only. Not for therapeutic Use.
ML385（Cat No.:I013677）is a small molecule inhibitor that targets the NRF2 (Nuclear factor erythroid 2-related factor 2) signaling pathway, a key regulator of cellular defense mechanisms against oxidative stress. By inhibiting NRF2, ML385 prevents the activation of antioxidant response elements, which may enhance the effectiveness of certain chemotherapy treatments and sensitize cancer cells to oxidative damage. Preclinical studies have shown ML385’s potential in cancer therapy, particularly in overcoming drug resistance and promoting tumor cell death.
| Catalog Number | I013677 |
| CAS Number | 846557-71-9 |
| Molecular Formula | C₃₁H₂₉N₃O₂S |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | DMSO: ≥ 30 mg/mL |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[5-methyl-4-[1-(2-methylbenzoyl)-2,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]acetamide |
| InChI | InChI=1S/C29H25N3O4S/c1-17-5-3-4-6-22(17)28(34)32-12-11-20-15-21(8-9-23(20)32)27-18(2)37-29(31-27)30-26(33)14-19-7-10-24-25(13-19)36-16-35-24/h3-10,13,15H,11-12,14,16H2,1-2H3,(H,30,31,33) |
| InChIKey | LINHYWKZVCNAMQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)N2CCC3=C2C=CC(=C3)C4=C(SC(=N4)NC(=O)CC5=CC6=C(C=C5)OCO6)C |
