For research use only. Not for therapeutic Use.
ML406(Cat No.:I012398)is a potent, selective inhibitor of the protein kinase CK2, known for its ability to target CK2α and CK2β subunits. This compound demonstrates significant potential in modulating key signaling pathways involved in cellular proliferation, survival, and apoptosis. By inhibiting CK2, ML406 has been studied for its therapeutic implications in cancer and inflammatory diseases. Its ability to disrupt dysregulated kinase activity makes it a valuable tool for investigating CK2’s role in various pathologies and as a promising candidate for drug development targeting CK2-related disorders.
CAS Number | 774589-47-8 |
Synonyms | 1-[4-[4-(1,3-Benzodioxole-5-carbonyl)piperazin-1-yl]phenyl]ethanone |
Molecular Formula | C20H20N2O4 |
Purity | ≥95% |
Target | Bacterial |
IUPAC Name | 1-[4-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]phenyl]ethanone |
InChI | InChI=1S/C20H20N2O4/c1-14(23)15-2-5-17(6-3-15)21-8-10-22(11-9-21)20(24)16-4-7-18-19(12-16)26-13-25-18/h2-7,12H,8-11,13H2,1H3 |
InChIKey | DMJGPASMZSNEAZ-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC=C(C=C1)N2CCN(CC2)C(=O)C3=CC4=C(C=C3)OCO4 |