For research use only. Not for therapeutic Use.
MLK-IN-1 is a potent, brain penetrant and specific mixed lineage kinase 3 (MLK-3) inhibitor, compound 68, extracted from patent US20140256733A1[1].
MLK-IN-1 (100 nM; pre-treatment 20 mins HIV-1 Tat) promotes continued axonogenesis in the presence of Tat-activated microglia and protects against effects of HIV-Tat in vitro[1].
| Catalog Number | I015385 |
| CAS Number | 1627729-62-7 |
| Synonyms | N-(3,4-dimethoxyphenyl)-3-(7-methoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine |
| Molecular Formula | C23H20N4O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C23H20N4O3S/c1-28-17-8-7-15(12-19(17)30-3)25-21-9-10-22-24-13-16(27(22)26-21)20-11-14-5-4-6-18(29-2)23(14)31-20/h4-13H,1-3H3,(H,25,26) |
| InChIKey | NTIXYCZKSHEEOH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NC2=NN3C(=NC=C3C4=CC5=C(S4)C(=CC=C5)OC)C=C2)OC |
| Reference | [1]. Val S. Goodfellow,et al.Mixed lineage kinase inhibitors and method of treatments. Patent US20140256733A1. |
