For research use only. Not for therapeutic Use.
MLN2480 (Cat No.:I000407)also known as BIIB-024, TAK580, AMG-2112819, BSK1369, or DAY-101, is an orally administered inhibitor of Raf kinases. By targeting Raf kinases, MLN2480 interferes with the signaling pathways involved in cell growth and proliferation. As a result, it has the potential to inhibit the growth of cancer cells that rely on aberrant Raf kinase activity. MLN2480 is being investigated for its therapeutic potential in various types of cancer, and its oral formulation offers convenience and ease of administration for patients undergoing treatment.
| Catalog Number | I000407 |
| CAS Number | 1096708-71-2 |
| Synonyms | 2-[(1R)-1-[(6-amino-5-chloropyrimidine-4-carbonyl)amino]ethyl]-N-[5-chloro-4-(trifluoromethyl)pyridin-2-yl]-1,3-thiazole-5-carboxamide |
| Molecular Formula | C₁₇H₁₂Cl₂F₃N₇O₂S |
| Purity | ≥95% |
| Target | Raf |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| InChI | InChI=1S/C17H12Cl2F3N7O2S/c1-6(28-15(31)12-11(19)13(23)27-5-26-12)16-25-4-9(32-16)14(30)29-10-2-7(17(20,21)22)8(18)3-24-10/h2-6H,1H3,(H,28,31)(H2,23,26,27)(H,24,29,30)/t6-/m1/s1 |
| InChIKey | VWMJHAFYPMOMGF-ZCFIWIBFSA-N |
| SMILES | CC(C1=NC=C(S1)C(=O)NC2=NC=C(C(=C2)C(F)(F)F)Cl)NC(=O)C3=C(C(=NC=N3)N)Cl |
| Reference | <p style=/line-height:25px/> |
