For research use only. Not for therapeutic Use.
MLN3126（Cat No.:I043474）is a selective small-molecule inhibitor targeting the Janus kinase 1 (JAK1), a key enzyme in the JAK-STAT signaling pathway, which regulates immune responses and hematopoiesis. By inhibiting JAK1, MLN3126 suppresses the activation of downstream inflammatory cytokines and immune cell signaling. This mechanism makes MLN3126 a promising candidate for treating autoimmune diseases, inflammatory conditions, and certain cancers driven by dysregulated immune responses. It is particularly explored for its potential in treating conditions such as rheumatoid arthritis and inflammatory bowel disease by modulating excessive immune activation and inflammation.
| CAS Number | 628300-71-0 |
| Synonyms | N-[4-chloro-2-(1-oxidopyridin-1-ium-4-carbonyl)phenyl]-4-propan-2-yloxybenzenesulfonamide |
| Molecular Formula | C21H19ClN2O5S |
| Purity | ≥95% |
| IUPAC Name | N-[4-chloro-2-(1-oxidopyridin-1-ium-4-carbonyl)phenyl]-4-propan-2-yloxybenzenesulfonamide |
| InChI | InChI=1S/C21H19ClN2O5S/c1-14(2)29-17-4-6-18(7-5-17)30(27,28)23-20-8-3-16(22)13-19(20)21(25)15-9-11-24(26)12-10-15/h3-14,23H,1-2H3 |
| InChIKey | YSCNTJOPTXIIJO-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=C(C=C2)Cl)C(=O)C3=CC=[N+](C=C3)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
