For research use only. Not for therapeutic Use.
MMAF-OMe (Monomethyl auristatin F – O-methyl ester)(Cat No.:I005184) is a synthetic derivative of monomethyl auristatin F (MMAF), a potent antimitotic agent. It works by inhibiting tubulin polymerization, leading to cell cycle arrest and apoptosis in rapidly dividing cells. MMAF-OMe is commonly used in the development of antibody-drug conjugates (ADCs), where it serves as the cytotoxic payload linked to monoclonal antibodies that specifically target cancer cells. The O-methyl ester modification improves the stability of the compound, making it more suitable for targeted drug delivery. MMAF-OMe is a crucial tool in cancer therapy research, offering highly selective cytotoxicity while sparing normal cells.
Catalog Number | I005184 |
CAS Number | 863971-12-4 |
Molecular Formula | C40H67N5O8 |
Purity | ≥95% |
Target | ADC Cytotoxin |
Solubility | DMSO |
Storage | -20°C |
IUPAC Name | methyl (2S)-2-[[(2R,3R)-3-methoxy-3-[(2S)-1-[(3R,4S,5S)-3-methoxy-5-methyl-4-[methyl-[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]butanoyl]amino]heptanoyl]pyrrolidin-2-yl]-2-methylpropanoyl]amino]-3-phenylpropanoate |
InChI | InChI=1S/C40H67N5O8/c1-13-26(6)35(44(9)39(49)34(25(4)5)43-38(48)33(41-8)24(2)3)31(51-10)23-32(46)45-21-17-20-30(45)36(52-11)27(7)37(47)42-29(40(50)53-12)22-28-18-15-14-16-19-28/h14-16,18-19,24-27,29-31,33-36,41H,13,17,20-23H2,1-12H3,(H,42,47)(H,43,48)/t26-,27+,29-,30-,31+,33-,34-,35-,36+/m0/s1 |
InChIKey | WRVLBJXFSHALRZ-FUVGGWJZSA-N |
SMILES | CC[C@H](C)[C@@H]([C@@H](CC(=O)N1CCC[C@H]1[C@@H]([C@@H](C)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)OC)OC)OC)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC |