For research use only. Not for therapeutic Use.
MMAF-OtBu (Cat No.: I040074) is a protected derivative of Monomethyl Auristatin F (MMAF), a potent antimitotic agent used in antibody-drug conjugate (ADC) development for cancer research. The OtBu (tert-butoxy) protecting group enhances stability and solubility, facilitating controlled release and targeted drug delivery. MMAF-OtBu inhibits tubulin polymerization, leading to cell cycle arrest and apoptosis in cancer cells. Ideal for ADC linker chemistry and cytotoxicity studies, it supports oncology drug discovery by improving tumor selectivity and therapeutic efficacy with reduced systemic toxicity.
| CAS Number | 745017-95-2 |
| Synonyms | tert-butyl (2S)-2-[[(2R,3R)-3-methoxy-3-[(2S)-1-[(3R,4S,5S)-3-methoxy-5-methyl-4-[methyl-[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]butanoyl]amino]heptanoyl]pyrrolidin-2-yl]-2-methylpropanoyl]amino]-3-phenylpropanoate |
| Molecular Formula | C43H73N5O8 |
| Purity | ≥95% |
| InChI | InChI=1S/C43H73N5O8/c1-15-28(6)37(47(12)41(52)36(27(4)5)46-40(51)35(44-11)26(2)3)33(54-13)25-34(49)48-23-19-22-32(48)38(55-14)29(7)39(50)45-31(42(53)56-43(8,9)10)24-30-20-17-16-18-21-30/h16-18,20-21,26-29,31-33,35-38,44H,15,19,22-25H2,1-14H3,(H,45,50)(H,46,51)/t28-,29+,31-,32-,33+,35-,36-,37-,38+/m0/s1 |
| InChIKey | HMBFRLXQUOOKLK-VFSYNPLYSA-N |
| SMILES | CCC(C)C(C(CC(=O)N1CCCC1C(C(C)C(=O)NC(CC2=CC=CC=C2)C(=O)OC(C)(C)C)OC)OC)N(C)C(=O)C(C(C)C)NC(=O)C(C(C)C)NC |
| Reference | [1]. Svetlana O, et al. DoroninaMonomethylvaline compounds capable of conjugation to ligands. Patent. WO2005081711. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
