For research use only. Not for therapeutic Use.
MMAF (Monomethyl auristatin F)（Cat No.:T000162）is a synthetic antimitotic agent derived from the natural product dolastatin 10, designed to inhibit tubulin polymerization and disrupt cell division. It is commonly used as a cytotoxic payload in antibody-drug conjugates (ADCs) for targeted cancer therapies. Unlike its analog MMAE, MMAF is less membrane-permeable, which reduces its off-target effects and toxicity to non-cancerous cells. Once delivered specifically to cancer cells via an ADC, MMAF induces apoptosis by arresting the cell cycle. It is widely studied in oncology for its potent anticancer properties.
| Catalog Number | T000162 |
| CAS Number | 745017-94-1 |
| Molecular Formula | C39H65N5O8 |
| Purity | ≥95% |
| Target | tubulin; |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | (2S)-2-[[(2R,3R)-3-methoxy-3-[(2S)-1-[(3R,4S,5S)-3-methoxy-5-methyl-4-[methyl-[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]butanoyl]amino]heptanoyl]pyrrolidin-2-yl]-2-methylpropanoyl]amino]-3-phenylpropanoic acid |
| InChI | InChI=1S/C39H65N5O8/c1-12-25(6)34(43(9)38(48)33(24(4)5)42-37(47)32(40-8)23(2)3)30(51-10)22-31(45)44-20-16-19-29(44)35(52-11)26(7)36(46)41-28(39(49)50)21-27-17-14-13-15-18-27/h13-15,17-18,23-26,28-30,32-35,40H,12,16,19-22H2,1-11H3,(H,41,46)(H,42,47)(H,49,5 |
| InChIKey | MFRNYXJJRJQHNW-NARUGQRUSA-N |
| SMILES | O=C([C@H](CC1=CC=CC=C1)NC([C@H](C)[C@H]([C@@H]2CCCN2C(C[C@@H](OC)C(N(C)C([C@@H](NC([C@H](C(C)C)NC)=O)C(C)C)=O)[C@@H](C)CC)=O)OC)=O)O |
| Reference | 1: Doronina SO, Mendelsohn BA, Bovee TD, Cerveny CG, Alley SC, Meyer DL, Oflazoglu E, Toki BE, Sanderson RJ, Zabinski RF, Wahl AF, Senter PD. Enhanced activity of monomethylauristatin F through monoclonal antibody delivery: effects of linker technology on efficacy and toxicity. Bioconjug Chem. 2006 Jan-Feb;17(1):114-24. PubMed PMID: 16417259. |
