For research use only. Not for therapeutic Use.
MMP-2 Inhibitor I(Cat No.:M052220)is a potent, selective inhibitor of matrix metalloproteinase-2 (MMP-2), an enzyme involved in the degradation of the extracellular matrix. MMP-2 plays a critical role in various physiological and pathological processes, including tissue remodeling, wound healing, and cancer metastasis. By inhibiting MMP-2, this compound is used in research to study its effects on inhibiting tumor progression, tissue invasion, and inflammation. MMP-2 Inhibitor I holds potential for therapeutic applications in treating diseases associated with excessive matrix degradation, such as cancer, fibrosis, and cardiovascular conditions.
CAS Number | 10335-69-0 |
Synonyms | (Z)-N-hydroxyoctadec-9-enamide |
Molecular Formula | C18H35NO2 |
Purity | ≥95% |
IUPAC Name | (Z)-N-hydroxyoctadec-9-enamide |
InChI | InChI=1S/C18H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)19-21/h9-10,21H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
InChIKey | LTXHELLMCCEDJG-KTKRTIGZSA-N |
SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |