For research use only. Not for therapeutic Use.
MMP2-IN-2（Cat No.:M122059）is a selective small-molecule inhibitor of matrix metalloproteinase-2 (MMP-2), an enzyme involved in the degradation of extracellular matrix components. MMP-2 plays a critical role in tissue remodeling, angiogenesis, and tumor invasion. By inhibiting MMP-2 activity, MMP2-IN-2 helps prevent cancer cell migration and metastasis, making it a promising candidate for anti-cancer therapies. Additionally, it may have therapeutic potential in treating cardiovascular and fibrotic diseases where excessive extracellular matrix breakdown occurs. MMP2-IN-2 is also a valuable research tool for studying MMP-2 function in various pathological conditions.
| CAS Number | 1772-39-0 |
| Synonyms | 6-nitro-2-(4-nitrophenyl)-1H-benzimidazole |
| Molecular Formula | C13H8N4O4 |
| Purity | ≥95% |
| IUPAC Name | 6-nitro-2-(4-nitrophenyl)-1H-benzimidazole |
| InChI | InChI=1S/C13H8N4O4/c18-16(19)9-3-1-8(2-4-9)13-14-11-6-5-10(17(20)21)7-12(11)15-13/h1-7H,(H,14,15) |
| InChIKey | XJIPBORERCFIIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(N2)C=C(C=C3)[N+](=O)[O-])[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
