For research use only. Not for therapeutic Use.
MMP2-IN-3（Cat No.:I043508）is a selective small-molecule inhibitor of matrix metalloproteinase-2 (MMP-2), an enzyme involved in the breakdown of extracellular matrix components during processes like angiogenesis, tissue remodeling, and tumor invasion. By targeting MMP-2, MMP2-IN-3 helps suppress cancer cell metastasis and tumor progression, making it a promising candidate for anti-cancer therapy. It may also have therapeutic applications in fibrotic and cardiovascular diseases, where excessive MMP-2 activity contributes to tissue damage. MMP2-IN-3 serves as a valuable research tool for exploring the role of MMP-2 in pathological conditions and for developing targeted therapeutic strategies.
| CAS Number | 897799-81-4 |
| Synonyms | N-[3-(6-methyl-1H-benzimidazol-2-yl)phenyl]-3-phenylpropanamide |
| Molecular Formula | C23H21N3O |
| Purity | ≥95% |
| IUPAC Name | N-[3-(6-methyl-1H-benzimidazol-2-yl)phenyl]-3-phenylpropanamide |
| InChI | InChI=1S/C23H21N3O/c1-16-10-12-20-21(14-16)26-23(25-20)18-8-5-9-19(15-18)24-22(27)13-11-17-6-3-2-4-7-17/h2-10,12,14-15H,11,13H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | BCWAEMAJIICXQI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)C3=CC(=CC=C3)NC(=O)CCC4=CC=CC=C4 |
