For research use only. Not for therapeutic Use.
MMRi62(Cat No.:I042485)is a potent small molecule inhibitor designed for cancer research. It targets specific signaling pathways involved in tumor growth and progression, offering potential therapeutic benefits for various cancer types. By inhibiting key enzymes and protein interactions, MMRi62 effectively disrupts the tumor microenvironment, promoting cancer cell death and inhibiting metastasis. Its selectivity and efficacy make it a promising candidate for combination therapies. Ongoing studies aim to further explore its potential in preclinical models and clinical trials, with a focus on its safety profile and long-term therapeutic outcomes.
CAS Number | 352693-80-2 |
Synonyms | 7-[(2,3-dichlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
Molecular Formula | C21H15Cl2N3O |
Purity | ≥95% |
IUPAC Name | 7-[(2,3-dichlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
InChI | InChI=1S/C21H15Cl2N3O/c22-16-7-3-6-14(18(16)23)20(26-17-8-1-2-11-24-17)15-10-9-13-5-4-12-25-19(13)21(15)27/h1-12,20,27H,(H,24,26) |
InChIKey | FMUBUUSODRAEMS-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)NC(C2=C(C(=CC=C2)Cl)Cl)C3=C(C4=C(C=CC=N4)C=C3)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |