For research use only. Not for therapeutic Use.
MMRi64(CAT: I032462) is a cereblon (CRBN) ligand-based degrader that functions as a potent IKZF1/IKZF3 degrader through targeted protein degradation. It belongs to the class of immunomodulatory drugs (IMiDs) that exploit cereblon as an E3 ligase substrate receptor to induce the selective degradation of transcription factors critical for cancer cell survival. By degrading IKZF1 and IKZF3, MMRi64 disrupts key signaling pathways in hematological malignancies, particularly multiple myeloma and certain lymphomas. Given its mechanism of action, MMRi64 is most relevant to Cancer Disease Research, where it is utilized to investigate targeted protein degradation strategies and advance therapeutic approaches for blood cancers.
| Catalog Number | I032462 |
| CAS Number | 430458-66-5 |
| Synonyms | 7-[(2,3-dichlorophenyl)-[(4-methylpyridin-2-yl)amino]methyl]quinolin-8-ol |
| Molecular Formula | C22H17Cl2N3O |
| Purity | ≥95% |
| IUPAC Name | 7-[(2,3-dichlorophenyl)-[(4-methylpyridin-2-yl)amino]methyl]quinolin-8-ol |
| InChI | InChI=1S/C22H17Cl2N3O/c1-13-9-11-25-18(12-13)27-21(15-5-2-6-17(23)19(15)24)16-8-7-14-4-3-10-26-20(14)22(16)28/h2-12,21,28H,1H3,(H,25,27) |
| InChIKey | HQICAVDTVBACIN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)NC(C2=C(C(=CC=C2)Cl)Cl)C3=C(C4=C(C=CC=N4)C=C3)O |
