For research use only. Not for therapeutic Use.
MMT-Hexylaminolinker Phosphoramidite（Cat No.:R033809）is a versatile reagent used in oligonucleotide synthesis for the introduction of hexylamino linkers. This compound features a 4,4′-dimethoxytrityl (MMT) protecting group, providing stability during the synthesis process. The hexylamino linker facilitates the attachment of peptides or other biomolecules to oligonucleotides, making it ideal for creating conjugates in various research applications. The phosphoramidite functionality enables efficient coupling with solid-phase oligonucleotide synthesis, ensuring reliable incorporation into the growing sequence. MMT-Hexylaminolinker Phosphoramidite is essential for synthesizing complex biomolecular constructs for gene therapy, diagnostics, and other molecular biology applications.
| CAS Number | 114616-27-2 |
| Synonyms | 3-[[di(propan-2-yl)amino]-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexoxy]phosphanyl]oxypropanenitrile |
| Molecular Formula | C35H48N3O3P |
| Purity | ≥95% |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexoxy]phosphanyl]oxypropanenitrile |
| InChI | InChI=1S/C35H48N3O3P/c1-29(2)38(30(3)4)42(41-28-16-25-36)40-27-15-7-6-14-26-37-35(31-17-10-8-11-18-31,32-19-12-9-13-20-32)33-21-23-34(39-5)24-22-33/h8-13,17-24,29-30,37H,6-7,14-16,26-28H2,1-5H3 |
| InChIKey | YBANXOPIYSVPMH-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)P(OCCCCCCNC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=C(C=C3)OC)OCCC#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
