For research use only. Not for therapeutic Use.
MN64(Cat No.:I005519)is a chemical compound that has been investigated for its potential therapeutic applications, particularly in the fields of cancer and neurodegenerative diseases. It is known for its ability to modulate various cellular pathways, including those involved in apoptosis, cell proliferation, and neuroprotection. In some studies, MN64 has been explored for its anti-tumor properties, as it may inhibit the growth of certain cancer cells. Additionally, research has suggested that MN64 may have neuroprotective effects, making it a candidate for the treatment of diseases like Alzheimer’s. Its full therapeutic potential is still under investigation.
CAS Number | 92831-11-3 |
Synonyms | MN-64; MN 64; MN64. |
Molecular Formula | C₁₈H₁₆O₂ |
Purity | ≥95% |
Target | Epigenetics |
Solubility | Soluble to 100 mM in DMSO and to 100 mM in ethanol |
Storage | -20°C |
IC50 | 6 nM |
IUPAC Name | 2-(4-propan-2-ylphenyl)chromen-4-one |
InChI | InChI=1S/C18H16O2/c1-12(2)13-7-9-14(10-8-13)18-11-16(19)15-5-3-4-6-17(15)20-18/h3-12H,1-2H3 |
InChIKey | PYTOHIUBXSJKQH-UHFFFAOYSA-N |
SMILES | CC(C)C1=CC=C(C=C1)C2=CC(=O)C3=CC=CC=C3O2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |