For research use only. Not for therapeutic Use.
MnTE-2-PyP chloride(Cat No.:I023570), also known as BMX-010 chloride, is a manganese porphyrin compound recognized for its potent reactive oxygen species (ROS) scavenging properties and radioprotective effects. It safeguards normal prostate tissue from radiation-induced damage and has been investigated for its potential in treating diabetic prostate cancer. In vitro studies demonstrate that MnTE-2-PyP chloride (30 μM) protects against hyperglycemia-induced cell death post-radiation. It also decreases the expression of NOX4 and α-SMA, key oxidative enzymes and pro-fibrotic molecules, respectively. Furthermore, MnTE-2-PyP chloride inhibits NF-κB activity by reducing DNA binding of the p50-p50 homodimer in irradiated hyperglycemic environments and enhances NRF2-mediated cytoprotection by increasing NRF2 protein expression and DNA binding. In vivo, MnTE-2-PyP chloride reduces tumor volume and improves survival rates in mouse models of prostate cancer. Additionally, it lowers blood glucose levels and inhibits pro-fibrotic signaling in diabetic models.
CAS Number | 219818-60-7 |
Molecular Formula | C48H44Cl5MnN8 |
Purity | ≥95% |
IUPAC Name | manganese(3+);(20Z)-5,10,15-tris(1-ethylpyridin-1-ium-2-yl)-20-(1-ethylpyridin-2-ylidene)porphyrin-22-ide;pentachloride |
InChI | InChI=1S/C48H44N8.5ClH.Mn/c1-5-53-29-13-9-17-41(53)45-33-21-23-35(49-33)46(42-18-10-14-30-54(42)6-2)37-25-27-39(51-37)48(44-20-12-16-32-56(44)8-4)40-28-26-38(52-40)47(36-24-22-34(45)50-36)43-19-11-15-31-55(43)7-3;;;;;;/h9-32H,5-8H2,1-4H3;5*1H;/q+2;;;;;;+3/p-5 |
InChIKey | UGVOBAHBYOONQU-UHFFFAOYSA-I |
SMILES | CCN\1C=CC=C/C1=C\2/C3=NC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=[N+]7CC)C8=CC=CC=[N+]8CC)C=C4)C9=CC=CC=[N+]9CC)C=C3.[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Mn+3] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |