For research use only. Not for therapeutic Use.
Sorafenib(CAT: I012394) is a multikinase inhibitor that targets several intracellular and cell surface kinases, including RAF kinases, vascular endothelial growth factor receptors (VEGFRs), and platelet-derived growth factor receptors (PDGFRs). By inhibiting these pathways, Sorafenib disrupts tumor cell proliferation and angiogenesis, making it a valuable therapeutic agent in oncology research. It is widely used in the treatment of hepatocellular carcinoma, renal cell carcinoma, and thyroid carcinoma. Its dual action on tumor growth and vascular development highlights its importance in advancing targeted cancer therapies and studying the mechanisms of kinase inhibition in various malignancies.
| Catalog Number | I012394 |
| CAS Number | 100012-18-8 |
| Synonyms | Sorafenib Nexavar BAY 43-9006 sorafenibum |
| Molecular Formula | C21H16ClF3N4O3 |
| Purity | ≥95% |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide |
| InChI | InChI=1S/C21H16ClF3N4O3/c1-26-19(30)18-11-15(8-9-27-18)32-14-5-2-12(3-6-14)28-20(31)29-13-4-7-17(22)16(10-13)21(23,24)25/h2-11H,1H3,(H,26,30)(H2,28,29,31) |
| InChIKey | MLDQJTXFUGDVEO-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F |
